gracep84 gracep84

31-10-2020
Geography

contestada

If the scale of the map is 1: 10,000 what would be the distance between A to C if it measured four (4) inches?

Respuesta :

vieirarocio vieirarocio

31-10-2020

Answer:

40,000

Explanation:

i think im sorry if its wrong

Answer Link

Otras preguntas

There are 18 swans in this pond. How many tadpoles are there? The ratio of newts to swans to tadpoles is 2: 3: 5

Identify the expected major product of the following reaction. [tex]\underset{\mathrm{H}_3 \mathrm{O}^{+}}{\longrightarrow}[/tex] ?CC(C)C(C)(O)COCC(O)C(C)(C)OCC

Women in the upper casted 2. How did the rule of the Gupta Dynasty reinforce patriarchy? In other words, what systems were in place regarding property, educatio

Kieran says the triangles need not be congruent. Do you agree with kieran? Explain what Kieran's diagrams show . Explain how Kieran could improve his ceasoning

Question 1 which line has a slope of -68.7 and a y intercept of -5.1 y=-5.1x-68.7 y=-5.1x=68.7 y=68.7x-5.1

Why do histones bind tightly to DNA? Â© Histones are positively charged, and DNA is negatively charged. Â© Both histones and DNA are strongly hydrophobic. â€¢ H

Please help me solve

from what structure does sensible perspiration occur

A quadrilateral has 2 pairs of parallel sides and no right angles. What shape could it be?

From a population that is normally distributed, a sample of 25 elements is selected and the standard deviation of the sample is computed. For the interval estim